C16H30N2S — CID 58004829
1-cyclopentyl-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea (PubChem CID 58004829) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 58004829 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-cyclopentyl-3-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1NC(=S)NC1CCCC1 |
| InChI | InChI=1S/C16H30N2S/c1-11(2)14-9-8-12(3)10-15(14)18-16(19)17-13-6-4-5-7-13/h11-15H,4-10H2,1-3H3,(H2,17,18,19)/t12-,14+,15+/m1/s1 |
| InChIKey | LTRXZXPLYSYUOK-SNPRPXQTSA-N |
| XLogP | 3.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|