About [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate
[2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate (PubChem CID 58004852) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate.
Molecular Properties
| Compound Name | [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate |
| PubChem CID | 58004852 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate |
| SMILES | C/C=C/C1(C(C)CC)OCC(COC(=O)CCCCCCC)O1 |
| InChI | InChI=1S/C19H34O4/c1-5-8-9-10-11-12-18(20)21-14-17-15-22-19(23-17,13-6-2)16(4)7-3/h6,13,16-17H,5,7-12,14-15H2,1-4H3/b13-6+ |
| InChIKey | GHGWFEORWBDUSC-AWNIVKPZSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate?
The IUPAC name of [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate (CID 58004852) is [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate.
What is the SMILES notation for [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate?
The canonical SMILES for [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate is C/C=C/C1(C(C)CC)OCC(COC(=O)CCCCCCC)O1.
What is the InChIKey of [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate?
The InChIKey is GHGWFEORWBDUSC-AWNIVKPZSA-N. The full InChI is InChI=1S/C19H34O4/c1-5-8-9-10-11-12-18(20)21-14-17-15-22-19(23-17,13-6-2)16(4)7-3/h6,13,16-17H,5,7-12,14-15H2,1-4H3/b13-6+.
What are the key properties of [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate?
[2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate has a molecular weight of 326.48 g/mol, XLogP of 4.62, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-butan-2-yl-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methyl octanoate is sourced from PubChem (CID 58004852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).