About (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate
(2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate (PubChem CID 58004868) has the molecular formula C17H28O5
and a molecular weight of 312.41 g/mol. Its IUPAC name is (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate.
Molecular Properties
| Compound Name | (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate |
| PubChem CID | 58004868 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate |
| SMILES | C/C=C/CCCCCCC(=O)OCC1COC(C)(C(C)=O)O1 |
| InChI | InChI=1S/C17H28O5/c1-4-5-6-7-8-9-10-11-16(19)20-12-15-13-21-17(3,22-15)14(2)18/h4-5,15H,6-13H2,1-3H3/b5-4+ |
| InChIKey | JHQWZDSPHLQSRB-SNAWJCMRSA-N |
| XLogP | 3.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate?
The IUPAC name of (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate (CID 58004868) is (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate.
What is the SMILES notation for (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate?
The canonical SMILES for (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate is C/C=C/CCCCCCC(=O)OCC1COC(C)(C(C)=O)O1.
What is the InChIKey of (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate?
The InChIKey is JHQWZDSPHLQSRB-SNAWJCMRSA-N. The full InChI is InChI=1S/C17H28O5/c1-4-5-6-7-8-9-10-11-16(19)20-12-15-13-21-17(3,22-15)14(2)18/h4-5,15H,6-13H2,1-3H3/b5-4+.
What are the key properties of (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate?
(2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate has a molecular weight of 312.41 g/mol, XLogP of 3.17, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl (E)-dec-8-enoate is sourced from PubChem (CID 58004868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).