C18H26F6O4 — CID 58004958
[1-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutyl]cyclopentyl] 2,2-dimethylbutanoate (PubChem CID 58004958) has the molecular formula C18H26F6O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is [1-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutyl]cyclopentyl] 2,2-dimethylbutanoate.
| Compound Name | [1-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutyl]cyclopentyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58004958 |
| Molecular Formula | C18H26F6O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [1-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutyl]cyclopentyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(CCCC(=O)OC(C(F)(F)F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C18H26F6O4/c1-4-15(2,3)14(26)28-16(9-5-6-10-16)11-7-8-12(25)27-13(17(19,20)21)18(22,23)24/h13H,4-11H2,1-3H3 |
| InChIKey | GHYYTNZFXOFIPH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |