C17H27F5O4 — CID 58004961
2,2,3,3,3-pentafluoropropyl 5-ethyl-5-(2-methylbutanoyloxy)heptanoate (PubChem CID 58004961) has the molecular formula C17H27F5O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 5-ethyl-5-(2-methylbutanoyloxy)heptanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 5-ethyl-5-(2-methylbutanoyloxy)heptanoate |
|---|---|
| PubChem CID | 58004961 |
| Molecular Formula | C17H27F5O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 5-ethyl-5-(2-methylbutanoyloxy)heptanoate |
| SMILES | CCC(C)C(=O)OC(CC)(CC)CCCC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H27F5O4/c1-5-12(4)14(24)26-15(6-2,7-3)10-8-9-13(23)25-11-16(18,19)17(20,21)22/h12H,5-11H2,1-4H3 |
| InChIKey | KUQHZVQFBIYSNP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|