C18H27F5O4 — CID 58004995
[1-[4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butyl]cyclopentyl] 2,2-dimethylbutanoate (PubChem CID 58004995) has the molecular formula C18H27F5O4 and a molecular weight of 402.40 g/mol. Its IUPAC name is [1-[4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butyl]cyclopentyl] 2,2-dimethylbutanoate.
| Compound Name | [1-[4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butyl]cyclopentyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58004995 |
| Molecular Formula | C18H27F5O4 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [1-[4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butyl]cyclopentyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(CCCC(=O)OCC(F)(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C18H27F5O4/c1-4-15(2,3)14(25)27-16(9-5-6-10-16)11-7-8-13(24)26-12-17(19,20)18(21,22)23/h4-12H2,1-3H3 |
| InChIKey | IVFKURNHFNFMGD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|