C18H28F6O4 — CID 58005006
1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate (PubChem CID 58005006) has the molecular formula C18H28F6O4 and a molecular weight of 422.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate |
|---|---|
| PubChem CID | 58005006 |
| Molecular Formula | C18H28F6O4 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2,2-dimethylbutanoyloxy)-5-ethylheptanoate |
| SMILES | CCC(CC)(CCCC(=O)OC(C(F)(F)F)C(F)(F)F)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C18H28F6O4/c1-6-15(4,5)14(26)28-16(7-2,8-3)11-9-10-12(25)27-13(17(19,20)21)18(22,23)24/h13H,6-11H2,1-5H3 |
| InChIKey | XLKQRSOSLKIVSV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |