C19H14F3NO3S — CID 58005292
5-[(1R)-5-[4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 58005292) has the molecular formula C19H14F3NO3S and a molecular weight of 393.39 g/mol. Its IUPAC name is 5-[(1R)-5-[4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(1R)-5-[4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58005292 |
| Molecular Formula | C19H14F3NO3S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 5-[(1R)-5-[4-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C([C@@H]2CCc3cc(Oc4ccc(C(F)(F)F)cc4)ccc32)S1 |
| InChI | InChI=1S/C19H14F3NO3S/c20-19(21,22)11-2-4-12(5-3-11)26-13-6-8-14-10(9-13)1-7-15(14)16-17(24)23-18(25)27-16/h2-6,8-9,15-16H,1,7H2,(H,23,24,25)/t15-,16?/m1/s1 |
| InChIKey | QTGNNTPLCFHLIV-AAFJCEBUSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|