C20H15BrN2O3S — CID 58005447
5-[(1R)-6-(2-bromo-4-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 58005447) has the molecular formula C20H15BrN2O3S and a molecular weight of 443.32 g/mol. Its IUPAC name is 5-[(1R)-6-(2-bromo-4-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(1R)-6-(2-bromo-4-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58005447 |
| Molecular Formula | C20H15BrN2O3S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 5-[(1R)-6-(2-bromo-4-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc3c(c2)CCC[C@H]3C2SC(=O)NC2=O)c(Br)c1 |
| InChI | InChI=1S/C20H15BrN2O3S/c1-22-12-5-8-17(16(21)10-12)26-13-6-7-14-11(9-13)3-2-4-15(14)18-19(24)23-20(25)27-18/h5-10,15,18H,2-4H2,(H,23,24,25)/t15-,18?/m1/s1 |
| InChIKey | HJOSGGJQTOMPIH-NNJIEVJOSA-N |
| XLogP | 5.56 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|