C30H35Cl2N3O3S — CID 58006761
(5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006761) has the molecular formula C30H35Cl2N3O3S and a molecular weight of 588.60 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006761 |
| Molecular Formula | C30H35Cl2N3O3S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC2(CO)COC2)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C30H35Cl2N3O3S/c1-18(2)24-25(27(37)34(19(3)4)14-30(15-36)16-38-17-30)39-28-33-29(5,21-8-12-23(32)13-9-21)26(35(24)28)20-6-10-22(31)11-7-20/h6-13,18-19,26,36H,14-17H2,1-5H3/t26-,29+/m1/s1 |
| InChIKey | YXBLKDRLKXWMTG-UHSQPCAPSA-N |
| XLogP | 6.48 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |