C30H33Cl2F3N4O2S — CID 58006778
(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006778) has the molecular formula C30H33Cl2F3N4O2S and a molecular weight of 641.59 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006778 |
| Molecular Formula | C30H33Cl2F3N4O2S |
| Molecular Weight | 641.59 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CCN(C)C(=O)C(F)(F)F)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C30H33Cl2F3N4O2S/c1-17(2)23-24(26(40)38(18(3)4)16-15-37(6)27(41)30(33,34)35)42-28-36-29(5,20-9-13-22(32)14-10-20)25(39(23)28)19-7-11-21(31)12-8-19/h7-14,17-18,25H,15-16H2,1-6H3/t25-,29+/m1/s1 |
| InChIKey | OJFOFTULPYOYML-IRPSRAIASA-N |
| XLogP | 7.49 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |