C30H43F3N2O4Si — CID 58006786
tert-butyl N-[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2,2,2-trifluoroacetyl)amino]butyl]-N-propan-2-ylcarbamate (PubChem CID 58006786) has the molecular formula C30H43F3N2O4Si and a molecular weight of 580.76 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2,2,2-trifluoroacetyl)amino]butyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2,2,2-trifluoroacetyl)amino]butyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 58006786 |
| Molecular Formula | C30H43F3N2O4Si |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | tert-butyl N-[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2,2,2-trifluoroacetyl)amino]butyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H43F3N2O4Si/c1-22(2)35(27(37)39-28(3,4)5)20-19-23(34-26(36)30(31,32)33)21-38-40(29(6,7)8,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,22-23H,19-21H2,1-8H3,(H,34,36)/t23-/m0/s1 |
| InChIKey | DDDKUYIDMVEJDS-QHCPKHFHSA-N |
| XLogP | 5.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|