C28H32Cl2N4O2S — CID 58006798
(5R,6S)-5,6-bis(4-chlorophenyl)-N-[(3S,4S)-4-hydroxy-1-methylpyrrolidin-3-yl]-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006798) has the molecular formula C28H32Cl2N4O2S and a molecular weight of 559.56 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-N-[(3S,4S)-4-hydroxy-1-methylpyrrolidin-3-yl]-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[(3S,4S)-4-hydroxy-1-methylpyrrolidin-3-yl]-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006798 |
| Molecular Formula | C28H32Cl2N4O2S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[(3S,4S)-4-hydroxy-1-methylpyrrolidin-3-yl]-N,6-dimethyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(C)[C@H]2CN(C)C[C@@H]2O)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C28H32Cl2N4O2S/c1-16(2)23-24(26(36)33(5)21-14-32(4)15-22(21)35)37-27-31-28(3,18-8-12-20(30)13-9-18)25(34(23)27)17-6-10-19(29)11-7-17/h6-13,16,21-22,25,35H,14-15H2,1-5H3/t21-,22-,25+,28-/m0/s1 |
| InChIKey | VRQAHCGDMYAJHK-CYTVTSDOSA-N |
| XLogP | 5.37 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |