C32H40Cl2N4O2S — CID 58006804
(5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-[(dimethylamino)methyl]oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58006804) has the molecular formula C32H40Cl2N4O2S and a molecular weight of 615.67 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-[(dimethylamino)methyl]oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-[(dimethylamino)methyl]oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58006804 |
| Molecular Formula | C32H40Cl2N4O2S |
| Molecular Weight | 615.67 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-N-[[3-[(dimethylamino)methyl]oxetan-3-yl]methyl]-6-methyl-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CC2(CN(C)C)COC2)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C32H40Cl2N4O2S/c1-20(2)26-27(29(39)37(21(3)4)17-32(16-36(6)7)18-40-19-32)41-30-35-31(5,23-10-14-25(34)15-11-23)28(38(26)30)22-8-12-24(33)13-9-22/h8-15,20-21,28H,16-19H2,1-7H3/t28-,31+/m1/s1 |
| InChIKey | NAOWQDBNPSTBGC-MVSFAKPFSA-N |
| XLogP | 7.05 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |