About 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol
2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol (PubChem CID 58006809) has the molecular formula C26H20Cl2N4O2
and a molecular weight of 491.38 g/mol. Its IUPAC name is 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol.
Molecular Properties
| Compound Name | 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol |
| PubChem CID | 58006809 |
| Molecular Formula | C26H20Cl2N4O2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccccc1C(/N=C/c1ccc(Cl)nc1)C(/N=C/c1ccc(Cl)nc1)c1ccccc1O |
| InChI | InChI=1S/C26H20Cl2N4O2/c27-23-11-9-17(13-29-23)15-31-25(19-5-1-3-7-21(19)33)26(20-6-2-4-8-22(20)34)32-16-18-10-12-24(28)30-14-18/h1-16,25-26,33-34H/b31-15+,32-16+ |
| InChIKey | KRXQYRYLTOVPSA-IHXWQEJPSA-N |
| XLogP | 6.22 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol?
The IUPAC name of 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol (CID 58006809) is 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol.
What is the SMILES notation for 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol?
The canonical SMILES for 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol is Oc1ccccc1C(/N=C/c1ccc(Cl)nc1)C(/N=C/c1ccc(Cl)nc1)c1ccccc1O.
What is the InChIKey of 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol?
The InChIKey is KRXQYRYLTOVPSA-IHXWQEJPSA-N. The full InChI is InChI=1S/C26H20Cl2N4O2/c27-23-11-9-17(13-29-23)15-31-25(19-5-1-3-7-21(19)33)26(20-6-2-4-8-22(20)34)32-16-18-10-12-24(28)30-14-18/h1-16,25-26,33-34H/b31-15+,32-16+.
What are the key properties of 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol?
2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol has a molecular weight of 491.38 g/mol, XLogP of 6.22, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,2-bis[(6-chloro-3-pyridinyl)methylideneamino]-2-(2-hydroxyphenyl)ethyl]phenol is sourced from PubChem (CID 58006809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).