C28H30Cl2N4O2S — CID 58006900
(2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide (PubChem CID 58006900) has the molecular formula C28H30Cl2N4O2S and a molecular weight of 557.55 g/mol. Its IUPAC name is (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide.
| Compound Name | (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 58006900 |
| Molecular Formula | C28H30Cl2N4O2S |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N2CC[C@H]2C(=O)N(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C28H30Cl2N4O2S/c1-16(2)22-23(26(36)33-15-14-21(33)25(35)32(4)5)37-27-31-28(3,18-8-12-20(30)13-9-18)24(34(22)27)17-6-10-19(29)11-7-17/h6-13,16,21,24H,14-15H2,1-5H3/t21-,24+,28-/m0/s1 |
| InChIKey | SJOTXTWUPGBVMJ-YBZFOXLFSA-N |
| XLogP | 5.93 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |