C14H25F3N2O4 — CID 58006935
tert-butyl N-propan-2-yl-N-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]carbamate (PubChem CID 58006935) has the molecular formula C14H25F3N2O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-propan-2-yl-N-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58006935 |
| Molecular Formula | C14H25F3N2O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]carbamate |
| SMILES | CC(C)N(CCOCCNC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25F3N2O4/c1-10(2)19(12(21)23-13(3,4)5)7-9-22-8-6-18-11(20)14(15,16)17/h10H,6-9H2,1-5H3,(H,18,20) |
| InChIKey | CZLAZZNVFMXTPQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|