C28H26Cl2N4O3S — CID 58007044
(2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-cyanopyrrolidine-2-carboxylic acid (PubChem CID 58007044) has the molecular formula C28H26Cl2N4O3S and a molecular weight of 569.51 g/mol. Its IUPAC name is (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-cyanopyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-cyanopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58007044 |
| Molecular Formula | C28H26Cl2N4O3S |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-cyanopyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C1=C(C(=O)N2[C@H](C#N)CC[C@H]2C(=O)O)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C28H26Cl2N4O3S/c1-15(2)22-23(25(35)33-20(14-31)12-13-21(33)26(36)37)38-27-32-28(3,17-6-10-19(30)11-7-17)24(34(22)27)16-4-8-18(29)9-5-16/h4-11,15,20-21,24H,12-13H2,1-3H3,(H,36,37)/t20-,21-,24+,28-/m0/s1 |
| InChIKey | GWFMHXAYCANQHY-LUTDDORASA-N |
| XLogP | 6.20 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |