C26H37F3N2O2Si — CID 58007176
N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(propan-2-ylamino)butan-2-yl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 58007176) has the molecular formula C26H37F3N2O2Si and a molecular weight of 494.67 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(propan-2-ylamino)butan-2-yl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(propan-2-ylamino)butan-2-yl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 58007176 |
| Molecular Formula | C26H37F3N2O2Si |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(propan-2-ylamino)butan-2-yl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CC(C)NCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C26H37F3N2O2Si/c1-20(2)30-18-17-21(31(6)24(32)26(27,28)29)19-33-34(25(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21,30H,17-19H2,1-6H3/t21-/m0/s1 |
| InChIKey | YLPNBYPISIYHPF-NRFANRHFSA-N |
| XLogP | 4.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|