C32H37Cl2F3N4O3S — CID 58007207
(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 58007207) has the molecular formula C32H37Cl2F3N4O3S and a molecular weight of 685.64 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 58007207 |
| Molecular Formula | C32H37Cl2F3N4O3S |
| Molecular Weight | 685.64 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N,3-di(propan-2-yl)-5H-imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N(CCOCCN(C)C(=O)C(F)(F)F)C(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C32H37Cl2F3N4O3S/c1-19(2)25-26(28(42)40(20(3)4)16-18-44-17-15-39(6)29(43)32(35,36)37)45-30-38-31(5,22-9-13-24(34)14-10-22)27(41(25)30)21-7-11-23(33)12-8-21/h7-14,19-20,27H,15-18H2,1-6H3/t27-,31+/m1/s1 |
| InChIKey | NQZHAXHTNRLHKQ-JOMNFKBKSA-N |
| XLogP | 7.51 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|