About 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide
4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide (PubChem CID 58008559) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide |
| PubChem CID | 58008559 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide |
| SMILES | CNc1ncc(C(N)=O)c(NC(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N5O/c1-7(12(2,3)4)16-10-8(9(13)18)6-15-11(14-5)17-10/h6-7H,1-5H3,(H2,13,18)(H2,14,15,16,17) |
| InChIKey | MVHCPJFWGSQTBV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide?
The IUPAC name of 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide (CID 58008559) is 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide.
What is the SMILES notation for 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide?
The canonical SMILES for 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide is CNc1ncc(C(N)=O)c(NC(C)C(C)(C)C)n1.
What is the InChIKey of 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide?
The InChIKey is MVHCPJFWGSQTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-7(12(2,3)4)16-10-8(9(13)18)6-15-11(14-5)17-10/h6-7H,1-5H3,(H2,13,18)(H2,14,15,16,17).
What are the key properties of 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide?
4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide has a molecular weight of 251.33 g/mol, XLogP of 1.46, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylbutan-2-ylamino)-2-(methylamino)pyrimidine-5-carboxamide is sourced from PubChem (CID 58008559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).