C13H20FN5 — CID 58008910
8-fluoro-N-[(3S)-2,2,4-trimethylpentan-3-yl]-7H-purin-6-amine (PubChem CID 58008910) has the molecular formula C13H20FN5 and a molecular weight of 265.34 g/mol. Its IUPAC name is 8-fluoro-N-[(3S)-2,2,4-trimethylpentan-3-yl]-7H-purin-6-amine.
| Compound Name | 8-fluoro-N-[(3S)-2,2,4-trimethylpentan-3-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 58008910 |
| Molecular Formula | C13H20FN5 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 8-fluoro-N-[(3S)-2,2,4-trimethylpentan-3-yl]-7H-purin-6-amine |
| SMILES | CC(C)[C@H](Nc1ncnc2nc(F)[nH]c12)C(C)(C)C |
| InChI | InChI=1S/C13H20FN5/c1-7(2)9(13(3,4)5)18-10-8-11(16-6-15-10)19-12(14)17-8/h6-7,9H,1-5H3,(H2,15,16,17,18,19)/t9-/m0/s1 |
| InChIKey | JFSPPONTLFIDQE-VIFPVBQESA-N |
| XLogP | 2.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |