C26H25ClN2O5S — CID 58009433
(E)-3-[4-[[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 58009433) has the molecular formula C26H25ClN2O5S and a molecular weight of 513.02 g/mol. Its IUPAC name is (E)-3-[4-[[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58009433 |
| Molecular Formula | C26H25ClN2O5S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (E)-3-[4-[[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(/C=C/C(=O)O)cc2)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C26H25ClN2O5S/c1-18-6-13-22(14-7-18)35(33,34)29(24-5-3-4-23(27)19(24)2)17-25(30)28-16-21-10-8-20(9-11-21)12-15-26(31)32/h3-15H,16-17H2,1-2H3,(H,28,30)(H,31,32)/b15-12+ |
| InChIKey | NGYDXRBPVCSTDI-NTCAYCPXSA-N |
| XLogP | 4.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|