C23H21FN2O5S — CID 58009575
3-[[[2-(3-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoic acid (PubChem CID 58009575) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[[[2-(3-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-(3-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 58009575 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-[[[2-(3-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCc2cccc(C(=O)O)c2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H21FN2O5S/c1-16-8-10-21(11-9-16)32(30,31)26(20-7-3-6-19(24)13-20)15-22(27)25-14-17-4-2-5-18(12-17)23(28)29/h2-13H,14-15H2,1H3,(H,25,27)(H,28,29) |
| InChIKey | PUNQXFBSOSYVFV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |