C28H33N5O4S — CID 58009897
tert-butyl N-[4-[5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]-1-bicyclo[2.2.2]octanyl]carbamate (PubChem CID 58009897) has the molecular formula C28H33N5O4S and a molecular weight of 535.67 g/mol. Its IUPAC name is tert-butyl N-[4-[5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]-1-bicyclo[2.2.2]octanyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]-1-bicyclo[2.2.2]octanyl]carbamate |
|---|---|
| PubChem CID | 58009897 |
| Molecular Formula | C28H33N5O4S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | tert-butyl N-[4-[5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]-1-bicyclo[2.2.2]octanyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2cnc(C45CCC(NC(=O)OC(C)(C)C)(CC4)CC5)n23)cc1 |
| InChI | InChI=1S/C28H33N5O4S/c1-19-5-7-21(8-6-19)38(35,36)32-16-9-22-23(32)29-17-20-18-30-24(33(20)22)27-10-13-28(14-11-27,15-12-27)31-25(34)37-26(2,3)4/h5-9,16-18H,10-15H2,1-4H3,(H,31,34) |
| InChIKey | FFTIEIUQKFMIKU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |