C13H12N6 — CID 58009932
3-methyl-11-(1-methylpyrazol-4-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene (PubChem CID 58009932) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-methyl-11-(1-methylpyrazol-4-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene.
| Compound Name | 3-methyl-11-(1-methylpyrazol-4-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 58009932 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-methyl-11-(1-methylpyrazol-4-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
| SMILES | Cn1cc(-c2cc3c(ncc4c[nH]n(C)c43)n2)cn1 |
| InChI | InChI=1S/C13H12N6/c1-18-7-9(6-15-18)11-3-10-12-8(5-16-19(12)2)4-14-13(10)17-11/h3-7,16H,1-2H3 |
| InChIKey | QVRMOHBVFBGTHK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |