C35H31N5O4S — CID 58010039
9H-fluoren-9-ylmethyl (3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]piperidine-1-carboxylate (PubChem CID 58010039) has the molecular formula C35H31N5O4S and a molecular weight of 617.73 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58010039 |
| Molecular Formula | C35H31N5O4S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2ncc([C@@H]4CCCN(C(=O)OCC5c6ccccc6-c6ccccc65)C4)n23)cc1 |
| InChI | InChI=1S/C35H31N5O4S/c1-23-12-14-25(15-13-23)45(42,43)39-18-16-31-34(39)37-20-33-36-19-32(40(31)33)24-7-6-17-38(21-24)35(41)44-22-30-28-10-4-2-8-26(28)27-9-3-5-11-29(27)30/h2-5,8-16,18-20,24,30H,6-7,17,21-22H2,1H3/t24-/m1/s1 |
| InChIKey | FPCYKCNMLJYOPE-XMMPIXPASA-N |
| XLogP | 6.36 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |