C10H11N5 — CID 58010154
2-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)ethanamine (PubChem CID 58010154) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)ethanamine.
| Compound Name | 2-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)ethanamine |
|---|---|
| PubChem CID | 58010154 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)ethanamine |
| SMILES | NCCc1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C10H11N5/c11-3-1-9-13-5-7-6-14-10-8(15(7)9)2-4-12-10/h2,4-6,12H,1,3,11H2 |
| InChIKey | MVVVJUBHIXONPI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |