C25H32N6O5S — CID 58010248
tert-butyl N-[4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclohexyl]carbamate (PubChem CID 58010248) has the molecular formula C25H32N6O5S and a molecular weight of 528.64 g/mol. Its IUPAC name is tert-butyl N-[4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58010248 |
| Molecular Formula | C25H32N6O5S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | tert-butyl N-[4-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclohexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)C4CCC(NC(=O)OC(C)(C)C)CC4)cnc32)cc1 |
| InChI | InChI=1S/C25H32N6O5S/c1-16-5-11-19(12-6-16)37(34,35)31-14-13-20-22(31)26-15-21(28-20)29-30-23(32)17-7-9-18(10-8-17)27-24(33)36-25(2,3)4/h5-6,11-15,17-18H,7-10H2,1-4H3,(H,27,33)(H,28,29)(H,30,32) |
| InChIKey | SFFCRLOLGCGQHQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|