About 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole
2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole (PubChem CID 58010376) has the molecular formula C21H26FN3O2S
and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole.
Molecular Properties
| Compound Name | 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
| PubChem CID | 58010376 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
| SMILES | CC(C)(C)Cn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21 |
| InChI | InChI=1S/C21H26FN3O2S/c1-20(2,3)13-25-17-8-7-14(11-16(17)24-19(25)21(4,5)6)28(26,27)15-9-10-23-18(22)12-15/h7-12H,13H2,1-6H3 |
| InChIKey | UNHIGUXZOZJMIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The IUPAC name of 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole (CID 58010376) is 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole.
What is the SMILES notation for 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The canonical SMILES for 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole is CC(C)(C)Cn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21.
What is the InChIKey of 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The InChIKey is UNHIGUXZOZJMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FN3O2S/c1-20(2,3)13-25-17-8-7-14(11-16(17)24-19(25)21(4,5)6)28(26,27)15-9-10-23-18(22)12-15/h7-12H,13H2,1-6H3.
What are the key properties of 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole has a molecular weight of 403.52 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-(2,2-dimethylpropyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole is sourced from PubChem (CID 58010376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).