C22H27F3N2O3S — CID 58010481
(Z)-4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanyl-1,1,1-trifluoro-5-hydroxypent-3-en-2-one (PubChem CID 58010481) has the molecular formula C22H27F3N2O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is (Z)-4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanyl-1,1,1-trifluoro-5-hydroxypent-3-en-2-one.
| Compound Name | (Z)-4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanyl-1,1,1-trifluoro-5-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 58010481 |
| Molecular Formula | C22H27F3N2O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (Z)-4-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfanyl-1,1,1-trifluoro-5-hydroxypent-3-en-2-one |
| SMILES | CC(C)(C)c1nc2cc(S/C(=C\C(=O)C(F)(F)F)CO)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C22H27F3N2O3S/c1-21(2,3)20-26-17-10-15(31-16(13-28)11-19(29)22(23,24)25)4-5-18(17)27(20)12-14-6-8-30-9-7-14/h4-5,10-11,14,28H,6-9,12-13H2,1-3H3/b16-11- |
| InChIKey | NAYAIMRSPYVSSQ-WJDWOHSUSA-N |
| XLogP | 4.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|