About methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate
methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate (PubChem CID 58011741) has the molecular formula C18H15ClFN3O3
and a molecular weight of 375.79 g/mol. Its IUPAC name is methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate |
| PubChem CID | 58011741 |
| Molecular Formula | C18H15ClFN3O3 |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nc(-c2ccc(Cl)cc2)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C18H15ClFN3O3/c1-26-16(24)11-23-18(25)22(10-13-4-2-3-5-15(13)20)17(21-23)12-6-8-14(19)9-7-12/h2-9H,10-11H2,1H3 |
| InChIKey | QCLNOVPSAHLKNK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate?
The IUPAC name of methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate (CID 58011741) is methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate is COC(=O)Cn1nc(-c2ccc(Cl)cc2)n(Cc2ccccc2F)c1=O.
What is the InChIKey of methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate?
The InChIKey is QCLNOVPSAHLKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClFN3O3/c1-26-16(24)11-23-18(25)22(10-13-4-2-3-5-15(13)20)17(21-23)12-6-8-14(19)9-7-12/h2-9H,10-11H2,1H3.
What are the key properties of methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate?
methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate has a molecular weight of 375.79 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 58011741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).