About 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine
4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine (PubChem CID 58012338) has the molecular formula C23H29Cl2N3
and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine |
| PubChem CID | 58012338 |
| Molecular Formula | C23H29Cl2N3 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine |
| SMILES | CCCC(CCC)c1ccc(Cl)c2nc(Nc3c(C)cc(Cl)cc3C)n(C)c12 |
| InChI | InChI=1S/C23H29Cl2N3/c1-6-8-16(9-7-2)18-10-11-19(25)21-22(18)28(5)23(27-21)26-20-14(3)12-17(24)13-15(20)4/h10-13,16H,6-9H2,1-5H3,(H,26,27) |
| InChIKey | LXOWKPYWILCSLK-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine?
The IUPAC name of 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine (CID 58012338) is 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine.
What is the SMILES notation for 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine?
The canonical SMILES for 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine is CCCC(CCC)c1ccc(Cl)c2nc(Nc3c(C)cc(Cl)cc3C)n(C)c12.
What is the InChIKey of 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine?
The InChIKey is LXOWKPYWILCSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29Cl2N3/c1-6-8-16(9-7-2)18-10-11-19(25)21-22(18)28(5)23(27-21)26-20-14(3)12-17(24)13-15(20)4/h10-13,16H,6-9H2,1-5H3,(H,26,27).
What are the key properties of 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine?
4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine has a molecular weight of 418.41 g/mol, XLogP of 7.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4-chloro-2,6-dimethylphenyl)-7-heptan-4-yl-1-methylbenzimidazol-2-amine is sourced from PubChem (CID 58012338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).