C14H25N7 — CID 58012607
2-methyl-4,6-bis(3-methylpiperazin-1-yl)-1,3,5-triazine (PubChem CID 58012607) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-methyl-4,6-bis(3-methylpiperazin-1-yl)-1,3,5-triazine.
| Compound Name | 2-methyl-4,6-bis(3-methylpiperazin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58012607 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-methyl-4,6-bis(3-methylpiperazin-1-yl)-1,3,5-triazine |
| SMILES | Cc1nc(N2CCNC(C)C2)nc(N2CCNC(C)C2)n1 |
| InChI | InChI=1S/C14H25N7/c1-10-8-20(6-4-15-10)13-17-12(3)18-14(19-13)21-7-5-16-11(2)9-21/h10-11,15-16H,4-9H2,1-3H3 |
| InChIKey | IYWHUIRZGUZOTH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |