About (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol
(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol (PubChem CID 58012763) has the molecular formula C12H28O2Si
and a molecular weight of 232.44 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol |
| PubChem CID | 58012763 |
| Molecular Formula | C12H28O2Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O2Si/c1-11(2,3)10(13)9-14-15(7,8)12(4,5)6/h10,13H,9H2,1-8H3/t10-/m1/s1 |
| InChIKey | AAJKOQWBSODMSA-SNVBAGLBSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol?
The IUPAC name of (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol (CID 58012763) is (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol.
What is the SMILES notation for (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol?
The canonical SMILES for (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol is CC(C)(C)[C@H](O)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol?
The InChIKey is AAJKOQWBSODMSA-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H28O2Si/c1-11(2,3)10(13)9-14-15(7,8)12(4,5)6/h10,13H,9H2,1-8H3/t10-/m1/s1.
What are the key properties of (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol?
(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol has a molecular weight of 232.44 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 58012763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).