C16H30N4S — CID 58012772
(2S)-N-[(2R)-3,3-dimethylbutan-2-yl]-3-methyl-2-[(1-methylimidazol-2-yl)methylamino]butanethioamide (PubChem CID 58012772) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is (2S)-N-[(2R)-3,3-dimethylbutan-2-yl]-3-methyl-2-[(1-methylimidazol-2-yl)methylamino]butanethioamide.
| Compound Name | (2S)-N-[(2R)-3,3-dimethylbutan-2-yl]-3-methyl-2-[(1-methylimidazol-2-yl)methylamino]butanethioamide |
|---|---|
| PubChem CID | 58012772 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (2S)-N-[(2R)-3,3-dimethylbutan-2-yl]-3-methyl-2-[(1-methylimidazol-2-yl)methylamino]butanethioamide |
| SMILES | CC(C)[C@H](NCc1nccn1C)C(=S)N[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C16H30N4S/c1-11(2)14(15(21)19-12(3)16(4,5)6)18-10-13-17-8-9-20(13)7/h8-9,11-12,14,18H,10H2,1-7H3,(H,19,21)/t12-,14+/m1/s1 |
| InChIKey | LTOZJPXSOPITDB-OCCSQVGLSA-N |
| XLogP | 2.89 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|