About 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium (PubChem CID 58013078) has the molecular formula C20H20F6IrN-
and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium |
| PubChem CID | 58013078 |
| Molecular Formula | C20H20F6IrN- |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium |
| SMILES | CCCCC(C)(C)c1ccnc(-c2[c-]c(C(F)(F)F)cc(C(F)(F)F)c2)c1.[Ir] |
| InChI | InChI=1S/C20H20F6N.Ir/c1-4-5-7-18(2,3)14-6-8-27-17(12-14)13-9-15(19(21,22)23)11-16(10-13)20(24,25)26;/h6,8-9,11-12H,4-5,7H2,1-3H3;/q-1; |
| InChIKey | HLURYHQISOKNBJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium (CID 58013078) is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium is CCCCC(C)(C)c1ccnc(-c2[c-]c(C(F)(F)F)cc(C(F)(F)F)c2)c1.[Ir].
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium?
The InChIKey is HLURYHQISOKNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F6N.Ir/c1-4-5-7-18(2,3)14-6-8-27-17(12-14)13-9-15(19(21,22)23)11-16(10-13)20(24,25)26;/h6,8-9,11-12H,4-5,7H2,1-3H3;/q-1;.
What are the key properties of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium?
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium has a molecular weight of 580.59 g/mol, XLogP of 7.05, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-(2-methylhexan-2-yl)pyridine;iridium is sourced from PubChem (CID 58013078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).