About [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate
[4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate (PubChem CID 58013105) has the molecular formula C33H40N4O2
and a molecular weight of 524.71 g/mol. Its IUPAC name is [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate.
Molecular Properties
| Compound Name | [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate |
| PubChem CID | 58013105 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3cc(C)c(OC(C)=O)c(C)c3)[nH]c2-c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C33H40N4O2/c1-8-36(9-2)28-16-12-25(13-17-28)30-31(26-14-18-29(19-15-26)37(10-3)11-4)35-33(34-30)27-20-22(5)32(23(6)21-27)39-24(7)38/h12-21H,8-11H2,1-7H3,(H,34,35) |
| InChIKey | SZIBZJJKXFIKRI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate?
The IUPAC name of [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate (CID 58013105) is [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate.
What is the SMILES notation for [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate?
The canonical SMILES for [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate is CCN(CC)c1ccc(-c2nc(-c3cc(C)c(OC(C)=O)c(C)c3)[nH]c2-c2ccc(N(CC)CC)cc2)cc1.
What is the InChIKey of [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate?
The InChIKey is SZIBZJJKXFIKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H40N4O2/c1-8-36(9-2)28-16-12-25(13-17-28)30-31(26-14-18-29(19-15-26)37(10-3)11-4)35-33(34-30)27-20-22(5)32(23(6)21-27)39-24(7)38/h12-21H,8-11H2,1-7H3,(H,34,35).
What are the key properties of [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate?
[4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate has a molecular weight of 524.71 g/mol, XLogP of 7.65, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4,5-bis[4-(diethylamino)phenyl]-1H-imidazol-2-yl]-2,6-dimethylphenyl] acetate is sourced from PubChem (CID 58013105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).