C19H29N3O11 — CID 58013512
1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3-dihydroxypentanedioate (PubChem CID 58013512) has the molecular formula C19H29N3O11 and a molecular weight of 475.45 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3-dihydroxypentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3-dihydroxypentanedioate |
|---|---|
| PubChem CID | 58013512 |
| Molecular Formula | C19H29N3O11 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3-dihydroxypentanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)CC)c(=O)n(CC(O)COC(=O)C(O)C(O)CC(=O)OC)c1=O |
| InChI | InChI=1S/C19H29N3O11/c1-4-6-20-17(29)21(8-11(23)5-2)19(31)22(18(20)30)9-12(24)10-33-16(28)15(27)13(25)7-14(26)32-3/h4,11-13,15,23-25,27H,1,5-10H2,2-3H3 |
| InChIKey | PPDZIITUGODQOH-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|