C20H31N3O12 — CID 58013513
1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4-trihydroxyhexanedioate (PubChem CID 58013513) has the molecular formula C20H31N3O12 and a molecular weight of 505.48 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4-trihydroxyhexanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4-trihydroxyhexanedioate |
|---|---|
| PubChem CID | 58013513 |
| Molecular Formula | C20H31N3O12 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4-trihydroxyhexanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)CC)c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)CC(=O)OC)c1=O |
| InChI | InChI=1S/C20H31N3O12/c1-4-6-21-18(31)22(8-11(24)5-2)20(33)23(19(21)32)9-12(25)10-35-17(30)16(29)15(28)13(26)7-14(27)34-3/h4,11-13,15-16,24-26,28-29H,1,5-10H2,2-3H3 |
| InChIKey | VGGFBRPWXODLND-UHFFFAOYSA-N |
| XLogP | -4.32 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|