C19H29N3O12 — CID 58013514
1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3,4-trihydroxypentanedioate (PubChem CID 58013514) has the molecular formula C19H29N3O12 and a molecular weight of 491.45 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3,4-trihydroxypentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3,4-trihydroxypentanedioate |
|---|---|
| PubChem CID | 58013514 |
| Molecular Formula | C19H29N3O12 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 5-O-methyl 2,3,4-trihydroxypentanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)CC)c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)C(=O)OC)c1=O |
| InChI | InChI=1S/C19H29N3O12/c1-4-6-20-17(30)21(7-10(23)5-2)19(32)22(18(20)31)8-11(24)9-34-16(29)14(27)12(25)13(26)15(28)33-3/h4,10-14,23-27H,1,5-9H2,2-3H3 |
| InChIKey | SMPSRJIPEKBXPG-UHFFFAOYSA-N |
| XLogP | -4.71 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|