C20H28O12 — CID 58013521
1-O-[2-hydroxy-3-[4-(2-hydroxybutylperoxymethyl)benzoyl]oxypropyl] 4-O-methyl 2,3-dihydroxybutanedioate (PubChem CID 58013521) has the molecular formula C20H28O12 and a molecular weight of 460.43 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[4-(2-hydroxybutylperoxymethyl)benzoyl]oxypropyl] 4-O-methyl 2,3-dihydroxybutanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[4-(2-hydroxybutylperoxymethyl)benzoyl]oxypropyl] 4-O-methyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 58013521 |
| Molecular Formula | C20H28O12 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-O-[2-hydroxy-3-[4-(2-hydroxybutylperoxymethyl)benzoyl]oxypropyl] 4-O-methyl 2,3-dihydroxybutanedioate |
| SMILES | CCC(O)COOCc1ccc(C(=O)OCC(O)COC(=O)C(O)C(O)C(=O)OC)cc1 |
| InChI | InChI=1S/C20H28O12/c1-3-14(21)11-32-31-8-12-4-6-13(7-5-12)18(25)29-9-15(22)10-30-20(27)17(24)16(23)19(26)28-2/h4-7,14-17,21-24H,3,8-11H2,1-2H3 |
| InChIKey | BOFKKFQONGKUGS-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|