C20H31N3O13 — CID 58013532
1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 58013532) has the molecular formula C20H31N3O13 and a molecular weight of 521.48 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 58013532 |
| Molecular Formula | C20H31N3O13 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 1-O-[2-hydroxy-3-[3-(2-hydroxybutyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-methyl 2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)CC)c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)C(O)C(=O)OC)c1=O |
| InChI | InChI=1S/C20H31N3O13/c1-4-6-21-18(32)22(7-10(24)5-2)20(34)23(19(21)33)8-11(25)9-36-17(31)15(29)13(27)12(26)14(28)16(30)35-3/h4,10-15,24-29H,1,5-9H2,2-3H3 |
| InChIKey | ATHGDGIVJJVYRL-UHFFFAOYSA-N |
| XLogP | -5.35 |
| TPSA | 239.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|