C11H12F6O4 — CID 58013554
1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-2-(2-methylprop-2-enoyloxy)propanoate (PubChem CID 58013554) has the molecular formula C11H12F6O4 and a molecular weight of 322.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-2-(2-methylprop-2-enoyloxy)propanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-2-(2-methylprop-2-enoyloxy)propanoate |
|---|---|
| PubChem CID | 58013554 |
| Molecular Formula | C11H12F6O4 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-2-(2-methylprop-2-enoyloxy)propanoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O4/c1-5(2)6(18)21-9(3,4)8(19)20-7(10(12,13)14)11(15,16)17/h7H,1H2,2-4H3 |
| InChIKey | ZDQZPEQDOALGMK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|