C11H18O — CID 58013636
(2R,3S,4S,5S)-2-ethynyl-3,4,5,6-tetramethyloxane (PubChem CID 58013636) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-ethynyl-3,4,5,6-tetramethyloxane.
| Compound Name | (2R,3S,4S,5S)-2-ethynyl-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 58013636 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2R,3S,4S,5S)-2-ethynyl-3,4,5,6-tetramethyloxane |
| SMILES | C#C[C@@H]1OC(C)[C@@H](C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H18O/c1-6-11-9(4)7(2)8(3)10(5)12-11/h1,7-11H,2-5H3/t7-,8-,9-,10?,11-/m0/s1 |
| InChIKey | UVHSAAMWAFQYGP-DNEDZOLUSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|