C18H29N3O5Si — CID 58013888
1-[4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-5-isocyano-3-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 58013888) has the molecular formula C18H29N3O5Si and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-5-isocyano-3-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-5-isocyano-3-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58013888 |
| Molecular Formula | C18H29N3O5Si |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-5-isocyano-3-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [C-]#[N+]C1(CO)OC(n2cc(C)c(=O)[nH]c2=O)C(C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29N3O5Si/c1-11-9-21(16(24)20-14(11)23)15-12(2)13(18(10-22,19-6)25-15)26-27(7,8)17(3,4)5/h9,12-13,15,22H,10H2,1-5,7-8H3,(H,20,23,24) |
| InChIKey | QPAJMEQNKZMPHJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|