About CID 58013917
CID 58013917 (PubChem CID 58013917) has the molecular formula C6H9BO2
and a molecular weight of 123.95 g/mol.
Molecular Properties
| Compound Name | CID 58013917 |
| PubChem CID | 58013917 |
| Molecular Formula | C6H9BO2 |
| Molecular Weight | 123.95 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | — |
| SMILES | [B]C1OC(=C)C(O)C1C |
| InChI | InChI=1S/C6H9BO2/c1-3-5(8)4(2)9-6(3)7/h3,5-6,8H,2H2,1H3 |
| InChIKey | URBIYTGMXXLWNP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.95 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58013917 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58013917?
The IUPAC name of CID 58013917 (CID 58013917) is not available.
What is the SMILES notation for CID 58013917?
The canonical SMILES for CID 58013917 is [B]C1OC(=C)C(O)C1C.
What is the InChIKey of CID 58013917?
The InChIKey is URBIYTGMXXLWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BO2/c1-3-5(8)4(2)9-6(3)7/h3,5-6,8H,2H2,1H3.
What are the key properties of CID 58013917?
CID 58013917 has a molecular weight of 123.95 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58013917 is sourced from PubChem (CID 58013917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).