C20H17FN6O3 — CID 58015499
(2R)-N'-[3-fluoro-5-(3-methyl-1,2-oxazol-5-yl)-2-pyridinyl]-2-(5-oxo-1,6-naphthyridin-6-yl)propanehydrazide (PubChem CID 58015499) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is (2R)-N'-[3-fluoro-5-(3-methyl-1,2-oxazol-5-yl)-2-pyridinyl]-2-(5-oxo-1,6-naphthyridin-6-yl)propanehydrazide.
| Compound Name | (2R)-N'-[3-fluoro-5-(3-methyl-1,2-oxazol-5-yl)-2-pyridinyl]-2-(5-oxo-1,6-naphthyridin-6-yl)propanehydrazide |
|---|---|
| PubChem CID | 58015499 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2R)-N'-[3-fluoro-5-(3-methyl-1,2-oxazol-5-yl)-2-pyridinyl]-2-(5-oxo-1,6-naphthyridin-6-yl)propanehydrazide |
| SMILES | Cc1cc(-c2cnc(NNC(=O)[C@@H](C)n3ccc4ncccc4c3=O)c(F)c2)on1 |
| InChI | InChI=1S/C20H17FN6O3/c1-11-8-17(30-26-11)13-9-15(21)18(23-10-13)24-25-19(28)12(2)27-7-5-16-14(20(27)29)4-3-6-22-16/h3-10,12H,1-2H3,(H,23,24)(H,25,28)/t12-/m1/s1 |
| InChIKey | VYSKOYNATMSCQS-GFCCVEGCSA-N |
| XLogP | 2.60 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|