C22H16F4N6O3 — CID 58015503
6-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2,2,2-trifluoroethoxy)-1,6-naphthyridin-5-one (PubChem CID 58015503) has the molecular formula C22H16F4N6O3 and a molecular weight of 488.40 g/mol. Its IUPAC name is 6-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2,2,2-trifluoroethoxy)-1,6-naphthyridin-5-one.
| Compound Name | 6-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2,2,2-trifluoroethoxy)-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 58015503 |
| Molecular Formula | C22H16F4N6O3 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 6-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2,2,2-trifluoroethoxy)-1,6-naphthyridin-5-one |
| SMILES | Cc1cc(-c2cc(F)c3nnc(C(C)n4ccc5ncc(OCC(F)(F)F)cc5c4=O)n3c2)on1 |
| InChI | InChI=1S/C22H16F4N6O3/c1-11-5-18(35-30-11)13-6-16(23)20-29-28-19(32(20)9-13)12(2)31-4-3-17-15(21(31)33)7-14(8-27-17)34-10-22(24,25)26/h3-9,12H,10H2,1-2H3 |
| InChIKey | KQCOUKVUTHONIC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |