C29H32F3N7O — CID 58015798
7-pentan-3-yl-2-(4-piperazin-1-ylanilino)-N-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 58015798) has the molecular formula C29H32F3N7O and a molecular weight of 551.62 g/mol. Its IUPAC name is 7-pentan-3-yl-2-(4-piperazin-1-ylanilino)-N-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-pentan-3-yl-2-(4-piperazin-1-ylanilino)-N-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 58015798 |
| Molecular Formula | C29H32F3N7O |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 7-pentan-3-yl-2-(4-piperazin-1-ylanilino)-N-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCC(CC)n1c(C(=O)Nc2cccc(C(F)(F)F)c2)cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C29H32F3N7O/c1-3-23(4-2)39-25(27(40)35-22-7-5-6-20(17-22)29(30,31)32)16-19-18-34-28(37-26(19)39)36-21-8-10-24(11-9-21)38-14-12-33-13-15-38/h5-11,16-18,23,33H,3-4,12-15H2,1-2H3,(H,35,40)(H,34,36,37) |
| InChIKey | BZCZFGMOKHQNOD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|